methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate

C13H10BrNO3 — CID 22318950

IUPACmethyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate
SMILESCOC(=O)c1cc(Br)c(=O)n(-c2ccccc2)c1
InChIInChI=1S/C13H10BrNO3/c1-18-13(17)9-7-11(14)12(16)15(8-9)10-5-3-2-4-6-10/h2-8H,1H3
InChIKeyQUXXZRRPAXEXNG-UHFFFAOYSA-N
MW308.13 g/mol
LogP2.39
Rot. Bonds2

About methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate

methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate (PubChem CID 22318950) has the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. Its IUPAC name is methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate
PubChem CID22318950
Molecular FormulaC13H10BrNO3
Molecular Weight308.13 g/mol
Exact Mass306.98
IUPAC Namemethyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate
SMILESCOC(=O)c1cc(Br)c(=O)n(-c2ccccc2)c1
InChIInChI=1S/C13H10BrNO3/c1-18-13(17)9-7-11(14)12(16)15(8-9)10-5-3-2-4-6-10/h2-8H,1H3
InChIKeyQUXXZRRPAXEXNG-UHFFFAOYSA-N
XLogP2.39
TPSA48.30 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.13
LogP ≤ 52.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate?
The IUPAC name of methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate (CID 22318950) is methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate.
What is the SMILES notation for methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate?
The canonical SMILES for methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate is COC(=O)c1cc(Br)c(=O)n(-c2ccccc2)c1.
What is the InChIKey of methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate?
The InChIKey is QUXXZRRPAXEXNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrNO3/c1-18-13(17)9-7-11(14)12(16)15(8-9)10-5-3-2-4-6-10/h2-8H,1H3.
What are the key properties of methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate?
methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate has a molecular weight of 308.13 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromo-6-oxo-1-phenylpyridine-3-carboxylate is sourced from PubChem (CID 22318950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).