methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate

C15H12BrNO4 — CID 661069

IUPACmethyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate
SMILESCOC(=O)c1cc(Br)c(=O)n(-c2ccc(C(C)=O)cc2)c1
InChIInChI=1S/C15H12BrNO4/c1-9(18)10-3-5-12(6-4-10)17-8-11(15(20)21-2)7-13(16)14(17)19/h3-8H,1-2H3
InChIKeyFLPMJCVCPWTSQP-UHFFFAOYSA-N
MW350.17 g/mol
LogP2.59
Rot. Bonds3

About methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate

methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate (PubChem CID 661069) has the molecular formula C15H12BrNO4 and a molecular weight of 350.17 g/mol. Its IUPAC name is methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate
PubChem CID661069
Molecular FormulaC15H12BrNO4
Molecular Weight350.17 g/mol
Exact Mass348.99
IUPAC Namemethyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate
SMILESCOC(=O)c1cc(Br)c(=O)n(-c2ccc(C(C)=O)cc2)c1
InChIInChI=1S/C15H12BrNO4/c1-9(18)10-3-5-12(6-4-10)17-8-11(15(20)21-2)7-13(16)14(17)19/h3-8H,1-2H3
InChIKeyFLPMJCVCPWTSQP-UHFFFAOYSA-N
XLogP2.59
TPSA65.37 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500350.17
LogP ≤ 52.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate?
The IUPAC name of methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate (CID 661069) is methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate.
What is the SMILES notation for methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate?
The canonical SMILES for methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate is COC(=O)c1cc(Br)c(=O)n(-c2ccc(C(C)=O)cc2)c1.
What is the InChIKey of methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate?
The InChIKey is FLPMJCVCPWTSQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrNO4/c1-9(18)10-3-5-12(6-4-10)17-8-11(15(20)21-2)7-13(16)14(17)19/h3-8H,1-2H3.
What are the key properties of methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate?
methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate has a molecular weight of 350.17 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(4-acetylphenyl)-5-bromo-6-oxopyridine-3-carboxylate is sourced from PubChem (CID 661069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).