C12H12 — CID 22321319
1,4,4a,4b-tetrahydrobiphenylene (PubChem CID 22321319) has the molecular formula C12H12 and a molecular weight of 156.23 g/mol. Its IUPAC name is 1,4,4a,4b-tetrahydrobiphenylene.
| Compound Name | 1,4,4a,4b-tetrahydrobiphenylene |
|---|---|
| PubChem CID | 22321319 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1,4,4a,4b-tetrahydrobiphenylene |
| SMILES | C1=CC2=C3CC=CCC3C2C=C1 |
| InChI | InChI=1S/C12H12/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-6,9,11H,7-8H2 |
| InChIKey | XNRXDPJIXQRKOV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|