C12H6N4O5 — CID 2232771
1,3-dinitropyrido[2,1-b]quinazolin-11-one (PubChem CID 2232771) has the molecular formula C12H6N4O5 and a molecular weight of 286.20 g/mol. Its IUPAC name is 1,3-dinitropyrido[2,1-b]quinazolin-11-one.
| Compound Name | 1,3-dinitropyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 2232771 |
| Molecular Formula | C12H6N4O5 |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 1,3-dinitropyrido[2,1-b]quinazolin-11-one |
| SMILES | O=c1c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2nc2ccccn12 |
| InChI | InChI=1S/C12H6N4O5/c17-12-11-8(13-10-3-1-2-4-14(10)12)5-7(15(18)19)6-9(11)16(20)21/h1-6H |
| InChIKey | JVJPGKWTTUJPCN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|