C27H26FN3O2 — CID 22330323
10-[4-[4-(2-fluorophenyl)piperazin-1-yl]-4-oxobutyl]acridin-9-one (PubChem CID 22330323) has the molecular formula C27H26FN3O2 and a molecular weight of 443.52 g/mol. Its IUPAC name is 10-[4-[4-(2-fluorophenyl)piperazin-1-yl]-4-oxobutyl]acridin-9-one.
| Compound Name | 10-[4-[4-(2-fluorophenyl)piperazin-1-yl]-4-oxobutyl]acridin-9-one |
|---|---|
| PubChem CID | 22330323 |
| Molecular Formula | C27H26FN3O2 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 10-[4-[4-(2-fluorophenyl)piperazin-1-yl]-4-oxobutyl]acridin-9-one |
| SMILES | O=C(CCCn1c2ccccc2c(=O)c2ccccc21)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H26FN3O2/c28-22-10-3-6-13-25(22)29-16-18-30(19-17-29)26(32)14-7-15-31-23-11-4-1-8-20(23)27(33)21-9-2-5-12-24(21)31/h1-6,8-13H,7,14-19H2 |
| InChIKey | BYSPSIYDGQRLSG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|