C23H26FN5O2 — CID 91951087
3-(dimethylamino)-1-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl]quinoxalin-2-one (PubChem CID 91951087) has the molecular formula C23H26FN5O2 and a molecular weight of 423.49 g/mol. Its IUPAC name is 3-(dimethylamino)-1-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl]quinoxalin-2-one.
| Compound Name | 3-(dimethylamino)-1-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl]quinoxalin-2-one |
|---|---|
| PubChem CID | 91951087 |
| Molecular Formula | C23H26FN5O2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 3-(dimethylamino)-1-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl]quinoxalin-2-one |
| SMILES | CN(C)c1nc2ccccc2n(CCC(=O)N2CCN(c3ccccc3F)CC2)c1=O |
| InChI | InChI=1S/C23H26FN5O2/c1-26(2)22-23(31)29(20-10-6-4-8-18(20)25-22)12-11-21(30)28-15-13-27(14-16-28)19-9-5-3-7-17(19)24/h3-10H,11-16H2,1-2H3 |
| InChIKey | KQFHBDGEDZVZAT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |