C28H31N5O2S — CID 22330642
4-[4-(4-methoxyphenyl)piperazin-1-yl]-5-methyl-N-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 22330642) has the molecular formula C28H31N5O2S and a molecular weight of 501.66 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)piperazin-1-yl]-5-methyl-N-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-[4-(4-methoxyphenyl)piperazin-1-yl]-5-methyl-N-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 22330642 |
| Molecular Formula | C28H31N5O2S |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)piperazin-1-yl]-5-methyl-N-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(N2CCN(c3ncnc4sc(C(=O)Nc5ccc(C(C)C)cc5)c(C)c34)CC2)cc1 |
| InChI | InChI=1S/C28H31N5O2S/c1-18(2)20-5-7-21(8-6-20)31-27(34)25-19(3)24-26(29-17-30-28(24)36-25)33-15-13-32(14-16-33)22-9-11-23(35-4)12-10-22/h5-12,17-18H,13-16H2,1-4H3,(H,31,34) |
| InChIKey | QNYTXHXKKQNQJL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|