C23H27N5O3S — CID 22330648
[4-[4-(4-methoxyphenyl)piperazin-1-yl]-5-methylthieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone (PubChem CID 22330648) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is [4-[4-(4-methoxyphenyl)piperazin-1-yl]-5-methylthieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[4-(4-methoxyphenyl)piperazin-1-yl]-5-methylthieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 22330648 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [4-[4-(4-methoxyphenyl)piperazin-1-yl]-5-methylthieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(N2CCN(c3ncnc4sc(C(=O)N5CCOCC5)c(C)c34)CC2)cc1 |
| InChI | InChI=1S/C23H27N5O3S/c1-16-19-21(27-9-7-26(8-10-27)17-3-5-18(30-2)6-4-17)24-15-25-22(19)32-20(16)23(29)28-11-13-31-14-12-28/h3-6,15H,7-14H2,1-2H3 |
| InChIKey | POTRIKZJCHMCOC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|