C23H26ClNO4 — CID 22344037
1-(1,3-benzodioxol-5-yl)-6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinoline;hydrochloride (PubChem CID 22344037) has the molecular formula C23H26ClNO4 and a molecular weight of 415.92 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinoline;hydrochloride.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 22344037 |
| Molecular Formula | C23H26ClNO4 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinoline;hydrochloride |
| SMILES | COc1cc2c(c3c1OC(C)(C)C3)C(c1ccc3c(c1)OCO3)=NC(C)(C)C2.Cl |
| InChI | InChI=1S/C23H25NO4.ClH/c1-22(2)10-14-9-18(25-5)21-15(11-23(3,4)28-21)19(14)20(24-22)13-6-7-16-17(8-13)27-12-26-16;/h6-9H,10-12H2,1-5H3;1H |
| InChIKey | DJSHQGYMLCJXBU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |