C25H31N3O3 — CID 23076991
3-amino-N-[3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)phenyl]propanamide (PubChem CID 23076991) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 3-amino-N-[3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)phenyl]propanamide.
| Compound Name | 3-amino-N-[3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 23076991 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 3-amino-N-[3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)phenyl]propanamide |
| SMILES | COc1cc2c(c3c1OC(C)(C)C3)C(c1cccc(NC(=O)CCN)c1)=NC(C)(C)C2 |
| InChI | InChI=1S/C25H31N3O3/c1-24(2)13-16-12-19(30-5)23-18(14-25(3,4)31-23)21(16)22(28-24)15-7-6-8-17(11-15)27-20(29)9-10-26/h6-8,11-12H,9-10,13-14,26H2,1-5H3,(H,27,29) |
| InChIKey | HRNXAGIUXJCACH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |