C25H29ClN2O3 — CID 22344025
2-chloro-N-[3-(6-ethoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)phenyl]acetamide (PubChem CID 22344025) has the molecular formula C25H29ClN2O3 and a molecular weight of 440.97 g/mol. Its IUPAC name is 2-chloro-N-[3-(6-ethoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[3-(6-ethoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 22344025 |
| Molecular Formula | C25H29ClN2O3 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-chloro-N-[3-(6-ethoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)phenyl]acetamide |
| SMILES | CCOc1cc2c(c3c1OC(C)(C)C3)C(c1cccc(NC(=O)CCl)c1)=NC(C)(C)C2 |
| InChI | InChI=1S/C25H29ClN2O3/c1-6-30-19-11-16-12-24(2,3)28-22(21(16)18-13-25(4,5)31-23(18)19)15-8-7-9-17(10-15)27-20(29)14-26/h7-11H,6,12-14H2,1-5H3,(H,27,29) |
| InChIKey | RONSYCFRKZKWIV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|