C24H28ClNO4 — CID 139900656
ethyl (3,3,8,8-tetramethyl-1-phenyl-4,9-dihydrofuro[2,3-h]isoquinolin-6-yl) carbonate;hydrochloride (PubChem CID 139900656) has the molecular formula C24H28ClNO4 and a molecular weight of 429.94 g/mol. Its IUPAC name is ethyl (3,3,8,8-tetramethyl-1-phenyl-4,9-dihydrofuro[2,3-h]isoquinolin-6-yl) carbonate;hydrochloride.
| Compound Name | ethyl (3,3,8,8-tetramethyl-1-phenyl-4,9-dihydrofuro[2,3-h]isoquinolin-6-yl) carbonate;hydrochloride |
|---|---|
| PubChem CID | 139900656 |
| Molecular Formula | C24H28ClNO4 |
| Molecular Weight | 429.94 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | ethyl (3,3,8,8-tetramethyl-1-phenyl-4,9-dihydrofuro[2,3-h]isoquinolin-6-yl) carbonate;hydrochloride |
| SMILES | CCOC(=O)Oc1cc2c(c3c1OC(C)(C)C3)C(c1ccccc1)=NC(C)(C)C2.Cl |
| InChI | InChI=1S/C24H27NO4.ClH/c1-6-27-22(26)28-18-12-16-13-23(2,3)25-20(15-10-8-7-9-11-15)19(16)17-14-24(4,5)29-21(17)18;/h7-12H,6,13-14H2,1-5H3;1H |
| InChIKey | KWUWRQFPOSZNFS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.94 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|