C26H31N3O4 — CID 23076756
N'-[3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)phenyl]butanediamide (PubChem CID 23076756) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is N'-[3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)phenyl]butanediamide.
| Compound Name | N'-[3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)phenyl]butanediamide |
|---|---|
| PubChem CID | 23076756 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N'-[3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)phenyl]butanediamide |
| SMILES | COc1cc2c(c3c1OC(C)(C)C3)C(c1cccc(NC(=O)CCC(N)=O)c1)=NC(C)(C)C2 |
| InChI | InChI=1S/C26H31N3O4/c1-25(2)13-16-12-19(32-5)24-18(14-26(3,4)33-24)22(16)23(29-25)15-7-6-8-17(11-15)28-21(31)10-9-20(27)30/h6-8,11-12H,9-10,13-14H2,1-5H3,(H2,27,30)(H,28,31) |
| InChIKey | IFOSFNSSROLEDO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |