C30H39N3O5 — CID 86605068
tert-butyl N-[3-[3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)anilino]-3-oxopropyl]carbamate (PubChem CID 86605068) has the molecular formula C30H39N3O5 and a molecular weight of 521.66 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)anilino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)anilino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 86605068 |
| Molecular Formula | C30H39N3O5 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | tert-butyl N-[3-[3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)anilino]-3-oxopropyl]carbamate |
| SMILES | COc1cc2c(c3c1OC(C)(C)C3)C(c1cccc(NC(=O)CCNC(=O)OC(C)(C)C)c1)=NC(C)(C)C2 |
| InChI | InChI=1S/C30H39N3O5/c1-28(2,3)38-27(35)31-13-12-23(34)32-20-11-9-10-18(14-20)25-24-19(16-29(4,5)33-25)15-22(36-8)26-21(24)17-30(6,7)37-26/h9-11,14-15H,12-13,16-17H2,1-8H3,(H,31,35)(H,32,34) |
| InChIKey | FTBJODDLECGZCE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |