C24H28N2O4 — CID 23076869
2-amino-4-(6-ethoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)benzoic acid (PubChem CID 23076869) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-amino-4-(6-ethoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)benzoic acid.
| Compound Name | 2-amino-4-(6-ethoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 23076869 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-amino-4-(6-ethoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)benzoic acid |
| SMILES | CCOc1cc2c(c3c1OC(C)(C)C3)C(c1ccc(C(=O)O)c(N)c1)=NC(C)(C)C2 |
| InChI | InChI=1S/C24H28N2O4/c1-6-29-18-10-14-11-23(2,3)26-20(13-7-8-15(22(27)28)17(25)9-13)19(14)16-12-24(4,5)30-21(16)18/h7-10H,6,11-12,25H2,1-5H3,(H,27,28) |
| InChIKey | WGNGTQZLAWAZHS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|