C22H25NO5 — CID 22344956
2-cyclopentyl-1-[5-(2,6-dimethyl-4-nitrophenoxy)-2-methoxyphenyl]ethanone (PubChem CID 22344956) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-cyclopentyl-1-[5-(2,6-dimethyl-4-nitrophenoxy)-2-methoxyphenyl]ethanone.
| Compound Name | 2-cyclopentyl-1-[5-(2,6-dimethyl-4-nitrophenoxy)-2-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 22344956 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-cyclopentyl-1-[5-(2,6-dimethyl-4-nitrophenoxy)-2-methoxyphenyl]ethanone |
| SMILES | COc1ccc(Oc2c(C)cc([N+](=O)[O-])cc2C)cc1C(=O)CC1CCCC1 |
| InChI | InChI=1S/C22H25NO5/c1-14-10-17(23(25)26)11-15(2)22(14)28-18-8-9-21(27-3)19(13-18)20(24)12-16-6-4-5-7-16/h8-11,13,16H,4-7,12H2,1-3H3 |
| InChIKey | CHLKIJSZCPRCRL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|