C24H25Cl2NO — CID 22345532
4-[3-[1,1-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenol (PubChem CID 22345532) has the molecular formula C24H25Cl2NO and a molecular weight of 414.38 g/mol. Its IUPAC name is 4-[3-[1,1-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenol.
| Compound Name | 4-[3-[1,1-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenol |
|---|---|
| PubChem CID | 22345532 |
| Molecular Formula | C24H25Cl2NO |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 4-[3-[1,1-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenol |
| SMILES | CN(CCCc1ccc(O)cc1)C(C)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H25Cl2NO/c1-24(19-7-11-21(25)12-8-19,20-9-13-22(26)14-10-20)27(2)17-3-4-18-5-15-23(28)16-6-18/h5-16,28H,3-4,17H2,1-2H3 |
| InChIKey | IWHMHKTVPLFMBS-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |