C32H40Cl2F3NO3Si — CID 70149478
N-[1,1-bis(4-chlorophenyl)ethyl]-N-methyl-3-[4-[(2S)-4,4,4-trifluoro-3-methoxy-3-trimethylsilyloxybutan-2-yl]oxyphenyl]propan-1-amine (PubChem CID 70149478) has the molecular formula C32H40Cl2F3NO3Si and a molecular weight of 642.66 g/mol. Its IUPAC name is N-[1,1-bis(4-chlorophenyl)ethyl]-N-methyl-3-[4-[(2S)-4,4,4-trifluoro-3-methoxy-3-trimethylsilyloxybutan-2-yl]oxyphenyl]propan-1-amine.
| Compound Name | N-[1,1-bis(4-chlorophenyl)ethyl]-N-methyl-3-[4-[(2S)-4,4,4-trifluoro-3-methoxy-3-trimethylsilyloxybutan-2-yl]oxyphenyl]propan-1-amine |
|---|---|
| PubChem CID | 70149478 |
| Molecular Formula | C32H40Cl2F3NO3Si |
| Molecular Weight | 642.66 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | N-[1,1-bis(4-chlorophenyl)ethyl]-N-methyl-3-[4-[(2S)-4,4,4-trifluoro-3-methoxy-3-trimethylsilyloxybutan-2-yl]oxyphenyl]propan-1-amine |
| SMILES | COC(O[Si](C)(C)C)([C@H](C)Oc1ccc(CCCN(C)C(C)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C32H40Cl2F3NO3Si/c1-23(31(39-4,32(35,36)37)41-42(5,6)7)40-29-20-10-24(11-21-29)9-8-22-38(3)30(2,25-12-16-27(33)17-13-25)26-14-18-28(34)19-15-26/h10-21,23H,8-9,22H2,1-7H3/t23-,31?/m0/s1 |
| InChIKey | LBGCPRUKQQQYRF-YNBNEFOKSA-N |
| XLogP | 9.35 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.66 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|