C27H24Cl2F3NO2 — CID 70122792
4-[4-[2-[1,1-bis(4-chlorophenyl)ethyl-methylamino]ethoxy]phenyl]-1,1,1-trifluorobut-3-en-2-one (PubChem CID 70122792) has the molecular formula C27H24Cl2F3NO2 and a molecular weight of 522.39 g/mol. Its IUPAC name is 4-[4-[2-[1,1-bis(4-chlorophenyl)ethyl-methylamino]ethoxy]phenyl]-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | 4-[4-[2-[1,1-bis(4-chlorophenyl)ethyl-methylamino]ethoxy]phenyl]-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 70122792 |
| Molecular Formula | C27H24Cl2F3NO2 |
| Molecular Weight | 522.39 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 4-[4-[2-[1,1-bis(4-chlorophenyl)ethyl-methylamino]ethoxy]phenyl]-1,1,1-trifluorobut-3-en-2-one |
| SMILES | CN(CCOc1ccc(C=CC(=O)C(F)(F)F)cc1)C(C)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H24Cl2F3NO2/c1-26(20-6-10-22(28)11-7-20,21-8-12-23(29)13-9-21)33(2)17-18-35-24-14-3-19(4-15-24)5-16-25(34)27(30,31)32/h3-16H,17-18H2,1-2H3 |
| InChIKey | LMRRJBJZHYOKST-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.39 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|