C15H30O4 — CID 22348655
3,4-dihydroxypentadecanoic acid (PubChem CID 22348655) has the molecular formula C15H30O4 and a molecular weight of 274.40 g/mol. Its IUPAC name is 3,4-dihydroxypentadecanoic acid.
| Compound Name | 3,4-dihydroxypentadecanoic acid |
|---|---|
| PubChem CID | 22348655 |
| Molecular Formula | C15H30O4 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 3,4-dihydroxypentadecanoic acid |
| SMILES | CCCCCCCCCCCC(O)C(O)CC(=O)O |
| InChI | InChI=1S/C15H30O4/c1-2-3-4-5-6-7-8-9-10-11-13(16)14(17)12-15(18)19/h13-14,16-17H,2-12H2,1H3,(H,18,19) |
| InChIKey | ZWTKIJQZIDZQGD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|