C13H15N — CID 22349552
6-ethynyl-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 22349552) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 6-ethynyl-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 6-ethynyl-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 22349552 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 6-ethynyl-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C#Cc1ccc2c(c1)C(N(C)C)CC2 |
| InChI | InChI=1S/C13H15N/c1-4-10-5-6-11-7-8-13(14(2)3)12(11)9-10/h1,5-6,9,13H,7-8H2,2-3H3 |
| InChIKey | GWAGEZXNQWUJHX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|