C21H16F3N3O3S2 — CID 22354906
2-methyl-2-[2-methyl-2-(2-nitrophenyl)sulfanyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropanoyl]propanedinitrile (PubChem CID 22354906) has the molecular formula C21H16F3N3O3S2 and a molecular weight of 479.51 g/mol. Its IUPAC name is 2-methyl-2-[2-methyl-2-(2-nitrophenyl)sulfanyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropanoyl]propanedinitrile.
| Compound Name | 2-methyl-2-[2-methyl-2-(2-nitrophenyl)sulfanyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropanoyl]propanedinitrile |
|---|---|
| PubChem CID | 22354906 |
| Molecular Formula | C21H16F3N3O3S2 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 2-methyl-2-[2-methyl-2-(2-nitrophenyl)sulfanyl-3-[4-(trifluoromethyl)phenyl]sulfanylpropanoyl]propanedinitrile |
| SMILES | CC(C#N)(C#N)C(=O)C(C)(CSc1ccc(C(F)(F)F)cc1)Sc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16F3N3O3S2/c1-19(11-25,12-26)18(28)20(2,32-17-6-4-3-5-16(17)27(29)30)13-31-15-9-7-14(8-10-15)21(22,23)24/h3-10H,13H2,1-2H3 |
| InChIKey | QGCIQQFGCFLDBO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 107.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|