C14H12N2O3S2 — CID 2820429
4-[(2,2-dimethyl-4-oxo-3H-thiopyran-6-yl)sulfanyl]-3-nitrobenzonitrile (PubChem CID 2820429) has the molecular formula C14H12N2O3S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-4-oxo-3H-thiopyran-6-yl)sulfanyl]-3-nitrobenzonitrile.
| Compound Name | 4-[(2,2-dimethyl-4-oxo-3H-thiopyran-6-yl)sulfanyl]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 2820429 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 4-[(2,2-dimethyl-4-oxo-3H-thiopyran-6-yl)sulfanyl]-3-nitrobenzonitrile |
| SMILES | CC1(C)CC(=O)C=C(Sc2ccc(C#N)cc2[N+](=O)[O-])S1 |
| InChI | InChI=1S/C14H12N2O3S2/c1-14(2)7-10(17)6-13(21-14)20-12-4-3-9(8-15)5-11(12)16(18)19/h3-6H,7H2,1-2H3 |
| InChIKey | LCYOYGCMOWJJHW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|