C21H27NO3 — CID 22360893
2-[(3,5-dimethoxyphenyl)methoxy]-1-phenylcyclohexan-1-amine (PubChem CID 22360893) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-[(3,5-dimethoxyphenyl)methoxy]-1-phenylcyclohexan-1-amine.
| Compound Name | 2-[(3,5-dimethoxyphenyl)methoxy]-1-phenylcyclohexan-1-amine |
|---|---|
| PubChem CID | 22360893 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-[(3,5-dimethoxyphenyl)methoxy]-1-phenylcyclohexan-1-amine |
| SMILES | COc1cc(COC2CCCCC2(N)c2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C21H27NO3/c1-23-18-12-16(13-19(14-18)24-2)15-25-20-10-6-7-11-21(20,22)17-8-4-3-5-9-17/h3-5,8-9,12-14,20H,6-7,10-11,15,22H2,1-2H3 |
| InChIKey | LEIMCJGNQOHHOU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |