C23H28N2O3 — CID 22360930
2-[(3,5-dimethoxyphenyl)methoxy]-1-indol-1-ylcyclohexan-1-amine (PubChem CID 22360930) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-[(3,5-dimethoxyphenyl)methoxy]-1-indol-1-ylcyclohexan-1-amine.
| Compound Name | 2-[(3,5-dimethoxyphenyl)methoxy]-1-indol-1-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 22360930 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-[(3,5-dimethoxyphenyl)methoxy]-1-indol-1-ylcyclohexan-1-amine |
| SMILES | COc1cc(COC2CCCCC2(N)n2ccc3ccccc32)cc(OC)c1 |
| InChI | InChI=1S/C23H28N2O3/c1-26-19-13-17(14-20(15-19)27-2)16-28-22-9-5-6-11-23(22,24)25-12-10-18-7-3-4-8-21(18)25/h3-4,7-8,10,12-15,22H,5-6,9,11,16,24H2,1-2H3 |
| InChIKey | LAZTXRPOLIYATK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |