C20H31N3O4 — CID 22362372
carbonic acid;N-cyclohexyl-4-(2-piperazin-1-ylethyl)benzamide (PubChem CID 22362372) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is carbonic acid;N-cyclohexyl-4-(2-piperazin-1-ylethyl)benzamide.
| Compound Name | carbonic acid;N-cyclohexyl-4-(2-piperazin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 22362372 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | carbonic acid;N-cyclohexyl-4-(2-piperazin-1-ylethyl)benzamide |
| SMILES | O=C(NC1CCCCC1)c1ccc(CCN2CCNCC2)cc1.O=C(O)O |
| InChI | InChI=1S/C19H29N3O.CH2O3/c23-19(21-18-4-2-1-3-5-18)17-8-6-16(7-9-17)10-13-22-14-11-20-12-15-22;2-1(3)4/h6-9,18,20H,1-5,10-15H2,(H,21,23);(H2,2,3,4) |
| InChIKey | JIPOTWKMQDWCCN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |