C16H15Cl4N5O — CID 22362579
3,5-dichloro-N-(diaminomethylidene)-1-(pyridin-4-ylmethyl)indole-2-carboxamide;dihydrochloride (PubChem CID 22362579) has the molecular formula C16H15Cl4N5O and a molecular weight of 435.14 g/mol. Its IUPAC name is 3,5-dichloro-N-(diaminomethylidene)-1-(pyridin-4-ylmethyl)indole-2-carboxamide;dihydrochloride.
| Compound Name | 3,5-dichloro-N-(diaminomethylidene)-1-(pyridin-4-ylmethyl)indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 22362579 |
| Molecular Formula | C16H15Cl4N5O |
| Molecular Weight | 435.14 g/mol |
| Exact Mass | 433.00 |
| IUPAC Name | 3,5-dichloro-N-(diaminomethylidene)-1-(pyridin-4-ylmethyl)indole-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=NC(=O)c1c(Cl)c2cc(Cl)ccc2n1Cc1ccncc1 |
| InChI | InChI=1S/C16H13Cl2N5O.2ClH/c17-10-1-2-12-11(7-10)13(18)14(15(24)22-16(19)20)23(12)8-9-3-5-21-6-4-9;;/h1-7H,8H2,(H4,19,20,22,24);2*1H |
| InChIKey | ROHCSCSZDPFAHZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.14 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|