C22H16Cl2N2OS — CID 146173983
5-chloro-1-[(4-chlorophenyl)methyl]-3-phenylsulfanylindole-2-carboxamide (PubChem CID 146173983) has the molecular formula C22H16Cl2N2OS and a molecular weight of 427.36 g/mol. Its IUPAC name is 5-chloro-1-[(4-chlorophenyl)methyl]-3-phenylsulfanylindole-2-carboxamide.
| Compound Name | 5-chloro-1-[(4-chlorophenyl)methyl]-3-phenylsulfanylindole-2-carboxamide |
|---|---|
| PubChem CID | 146173983 |
| Molecular Formula | C22H16Cl2N2OS |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 5-chloro-1-[(4-chlorophenyl)methyl]-3-phenylsulfanylindole-2-carboxamide |
| SMILES | NC(=O)c1c(Sc2ccccc2)c2cc(Cl)ccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16Cl2N2OS/c23-15-8-6-14(7-9-15)13-26-19-11-10-16(24)12-18(19)21(20(26)22(25)27)28-17-4-2-1-3-5-17/h1-12H,13H2,(H2,25,27) |
| InChIKey | YSLUFWVDWGLTEX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |