C23H15ClF3NO2S — CID 56840212
3-[1-benzyl-6-chloro-2-(trifluoromethyl)indol-3-yl]sulfanylbenzoic acid (PubChem CID 56840212) has the molecular formula C23H15ClF3NO2S and a molecular weight of 461.89 g/mol. Its IUPAC name is 3-[1-benzyl-6-chloro-2-(trifluoromethyl)indol-3-yl]sulfanylbenzoic acid.
| Compound Name | 3-[1-benzyl-6-chloro-2-(trifluoromethyl)indol-3-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 56840212 |
| Molecular Formula | C23H15ClF3NO2S |
| Molecular Weight | 461.89 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 3-[1-benzyl-6-chloro-2-(trifluoromethyl)indol-3-yl]sulfanylbenzoic acid |
| SMILES | O=C(O)c1cccc(Sc2c(C(F)(F)F)n(Cc3ccccc3)c3cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C23H15ClF3NO2S/c24-16-9-10-18-19(12-16)28(13-14-5-2-1-3-6-14)21(23(25,26)27)20(18)31-17-8-4-7-15(11-17)22(29)30/h1-12H,13H2,(H,29,30) |
| InChIKey | CQRFMLHBQRRNNP-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.89 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |