C21H17BrClN3O2S — CID 118874630
3-[2-bromo-6-chloro-1-(1-propan-2-ylpyrazol-4-yl)indol-3-yl]sulfanylbenzoic acid (PubChem CID 118874630) has the molecular formula C21H17BrClN3O2S and a molecular weight of 490.81 g/mol. Its IUPAC name is 3-[2-bromo-6-chloro-1-(1-propan-2-ylpyrazol-4-yl)indol-3-yl]sulfanylbenzoic acid.
| Compound Name | 3-[2-bromo-6-chloro-1-(1-propan-2-ylpyrazol-4-yl)indol-3-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 118874630 |
| Molecular Formula | C21H17BrClN3O2S |
| Molecular Weight | 490.81 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | 3-[2-bromo-6-chloro-1-(1-propan-2-ylpyrazol-4-yl)indol-3-yl]sulfanylbenzoic acid |
| SMILES | CC(C)n1cc(-n2c(Br)c(Sc3cccc(C(=O)O)c3)c3ccc(Cl)cc32)cn1 |
| InChI | InChI=1S/C21H17BrClN3O2S/c1-12(2)25-11-15(10-24-25)26-18-9-14(23)6-7-17(18)19(20(26)22)29-16-5-3-4-13(8-16)21(27)28/h3-12H,1-2H3,(H,27,28) |
| InChIKey | FHJVLEBYAZBQJQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.81 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |