C26H20ClN3O2S — CID 66764822
3-[6-chloro-2-methyl-1-[1-(2-methylphenyl)pyrazol-4-yl]indol-3-yl]sulfanylbenzoic acid (PubChem CID 66764822) has the molecular formula C26H20ClN3O2S and a molecular weight of 473.99 g/mol. Its IUPAC name is 3-[6-chloro-2-methyl-1-[1-(2-methylphenyl)pyrazol-4-yl]indol-3-yl]sulfanylbenzoic acid.
| Compound Name | 3-[6-chloro-2-methyl-1-[1-(2-methylphenyl)pyrazol-4-yl]indol-3-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 66764822 |
| Molecular Formula | C26H20ClN3O2S |
| Molecular Weight | 473.99 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 3-[6-chloro-2-methyl-1-[1-(2-methylphenyl)pyrazol-4-yl]indol-3-yl]sulfanylbenzoic acid |
| SMILES | Cc1ccccc1-n1cc(-n2c(C)c(Sc3cccc(C(=O)O)c3)c3ccc(Cl)cc32)cn1 |
| InChI | InChI=1S/C26H20ClN3O2S/c1-16-6-3-4-9-23(16)29-15-20(14-28-29)30-17(2)25(22-11-10-19(27)13-24(22)30)33-21-8-5-7-18(12-21)26(31)32/h3-15H,1-2H3,(H,31,32) |
| InChIKey | MCWWUNAXJBPPEU-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.99 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |