C23H22ClN3O2S — CID 66764946
ethyl 3-[6-chloro-1-(1-ethylpyrazol-4-yl)-2-methylindol-3-yl]sulfanylbenzoate (PubChem CID 66764946) has the molecular formula C23H22ClN3O2S and a molecular weight of 439.97 g/mol. Its IUPAC name is ethyl 3-[6-chloro-1-(1-ethylpyrazol-4-yl)-2-methylindol-3-yl]sulfanylbenzoate.
| Compound Name | ethyl 3-[6-chloro-1-(1-ethylpyrazol-4-yl)-2-methylindol-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 66764946 |
| Molecular Formula | C23H22ClN3O2S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | ethyl 3-[6-chloro-1-(1-ethylpyrazol-4-yl)-2-methylindol-3-yl]sulfanylbenzoate |
| SMILES | CCOC(=O)c1cccc(Sc2c(C)n(-c3cnn(CC)c3)c3cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C23H22ClN3O2S/c1-4-26-14-18(13-25-26)27-15(3)22(20-10-9-17(24)12-21(20)27)30-19-8-6-7-16(11-19)23(28)29-5-2/h6-14H,4-5H2,1-3H3 |
| InChIKey | LTICLZLZFVQDLC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |