C19H15ClN4O2S — CID 118874696
3-[2-amino-6-chloro-1-(1-methylpyrazol-4-yl)indol-3-yl]sulfanylbenzoic acid (PubChem CID 118874696) has the molecular formula C19H15ClN4O2S and a molecular weight of 398.88 g/mol. Its IUPAC name is 3-[2-amino-6-chloro-1-(1-methylpyrazol-4-yl)indol-3-yl]sulfanylbenzoic acid.
| Compound Name | 3-[2-amino-6-chloro-1-(1-methylpyrazol-4-yl)indol-3-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 118874696 |
| Molecular Formula | C19H15ClN4O2S |
| Molecular Weight | 398.88 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 3-[2-amino-6-chloro-1-(1-methylpyrazol-4-yl)indol-3-yl]sulfanylbenzoic acid |
| SMILES | Cn1cc(-n2c(N)c(Sc3cccc(C(=O)O)c3)c3ccc(Cl)cc32)cn1 |
| InChI | InChI=1S/C19H15ClN4O2S/c1-23-10-13(9-22-23)24-16-8-12(20)5-6-15(16)17(18(24)21)27-14-4-2-3-11(7-14)19(25)26/h2-10H,21H2,1H3,(H,25,26) |
| InChIKey | UMDIIVJJLIVCDW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.88 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |