C15H15N3O5 — CID 22363670
(3-hydroxy-4-phenylmethoxy-2-pyridinyl) N-(2-aminoacetyl)carbamate (PubChem CID 22363670) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is (3-hydroxy-4-phenylmethoxy-2-pyridinyl) N-(2-aminoacetyl)carbamate.
| Compound Name | (3-hydroxy-4-phenylmethoxy-2-pyridinyl) N-(2-aminoacetyl)carbamate |
|---|---|
| PubChem CID | 22363670 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (3-hydroxy-4-phenylmethoxy-2-pyridinyl) N-(2-aminoacetyl)carbamate |
| SMILES | NCC(=O)NC(=O)Oc1nccc(OCc2ccccc2)c1O |
| InChI | InChI=1S/C15H15N3O5/c16-8-12(19)18-15(21)23-14-13(20)11(6-7-17-14)22-9-10-4-2-1-3-5-10/h1-7,20H,8-9,16H2,(H,18,19,21) |
| InChIKey | NLTZYTOHIBIJCE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 123.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |