C11H24Cl2N2O4 — CID 22364631
dimethyl 2,2-bis(3-aminopropyl)propanedioate;dihydrochloride (PubChem CID 22364631) has the molecular formula C11H24Cl2N2O4 and a molecular weight of 319.23 g/mol. Its IUPAC name is dimethyl 2,2-bis(3-aminopropyl)propanedioate;dihydrochloride.
| Compound Name | dimethyl 2,2-bis(3-aminopropyl)propanedioate;dihydrochloride |
|---|---|
| PubChem CID | 22364631 |
| Molecular Formula | C11H24Cl2N2O4 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | dimethyl 2,2-bis(3-aminopropyl)propanedioate;dihydrochloride |
| SMILES | COC(=O)C(CCCN)(CCCN)C(=O)OC.Cl.Cl |
| InChI | InChI=1S/C11H22N2O4.2ClH/c1-16-9(14)11(5-3-7-12,6-4-8-13)10(15)17-2;;/h3-8,12-13H2,1-2H3;2*1H |
| InChIKey | HHSONYKTUSVWKD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|