C22H27BrN2O3 — CID 2236530
2-[2-bromo-4-[(cyclopentylamino)methyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 2236530) has the molecular formula C22H27BrN2O3 and a molecular weight of 447.37 g/mol. Its IUPAC name is 2-[2-bromo-4-[(cyclopentylamino)methyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(cyclopentylamino)methyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 2236530 |
| Molecular Formula | C22H27BrN2O3 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 2-[2-bromo-4-[(cyclopentylamino)methyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(CNC2CCCC2)cc(Br)c1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C22H27BrN2O3/c1-15-7-3-6-10-19(15)25-21(26)14-28-22-18(23)11-16(12-20(22)27-2)13-24-17-8-4-5-9-17/h3,6-7,10-12,17,24H,4-5,8-9,13-14H2,1-2H3,(H,25,26) |
| InChIKey | MYECUKZYIIURTN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |