C24H22ClNO5 — CID 22373664
diethyl 4-[[4-(4-chlorobenzoyl)phenyl]methyl]-1H-pyrrole-2,3-dicarboxylate (PubChem CID 22373664) has the molecular formula C24H22ClNO5 and a molecular weight of 439.90 g/mol. Its IUPAC name is diethyl 4-[[4-(4-chlorobenzoyl)phenyl]methyl]-1H-pyrrole-2,3-dicarboxylate.
| Compound Name | diethyl 4-[[4-(4-chlorobenzoyl)phenyl]methyl]-1H-pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 22373664 |
| Molecular Formula | C24H22ClNO5 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | diethyl 4-[[4-(4-chlorobenzoyl)phenyl]methyl]-1H-pyrrole-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]cc(Cc2ccc(C(=O)c3ccc(Cl)cc3)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C24H22ClNO5/c1-3-30-23(28)20-18(14-26-21(20)24(29)31-4-2)13-15-5-7-16(8-6-15)22(27)17-9-11-19(25)12-10-17/h5-12,14,26H,3-4,13H2,1-2H3 |
| InChIKey | SWJKREVXPGDPPB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |