C29H29F3N2O4 — CID 22373833
(E)-but-2-enedioic acid;N-[3-(4-naphthalen-1-yl-3,6-dihydro-2H-pyridin-1-yl)propyl]-3-(trifluoromethyl)aniline (PubChem CID 22373833) has the molecular formula C29H29F3N2O4 and a molecular weight of 526.56 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[3-(4-naphthalen-1-yl-3,6-dihydro-2H-pyridin-1-yl)propyl]-3-(trifluoromethyl)aniline.
| Compound Name | (E)-but-2-enedioic acid;N-[3-(4-naphthalen-1-yl-3,6-dihydro-2H-pyridin-1-yl)propyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 22373833 |
| Molecular Formula | C29H29F3N2O4 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[3-(4-naphthalen-1-yl-3,6-dihydro-2H-pyridin-1-yl)propyl]-3-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cccc(NCCCN2CC=C(c3cccc4ccccc34)CC2)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C25H25F3N2.C4H4O4/c26-25(27,28)21-8-4-9-22(18-21)29-14-5-15-30-16-12-20(13-17-30)24-11-3-7-19-6-1-2-10-23(19)24;5-3(6)1-2-4(7)8/h1-4,6-12,18,29H,5,13-17H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | BQGPWSBYQZHOEI-WLHGVMLRSA-N |
| XLogP | 6.16 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|