C27H49O11- — CID 22378403
2-(2,3-dihydroxypropyl)octadecanoate;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 22378403) has the molecular formula C27H49O11- and a molecular weight of 549.68 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)octadecanoate;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-(2,3-dihydroxypropyl)octadecanoate;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 22378403 |
| Molecular Formula | C27H49O11- |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)octadecanoate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCCCCCCCCCCCCCCCC(CC(O)CO)C(=O)[O-].O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H42O4.C6H8O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(21(24)25)17-20(23)18-22;7-3(8)1-6(13,5(11)12)2-4(9)10/h19-20,22-23H,2-18H2,1H3,(H,24,25);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-1 |
| InChIKey | BIHMAMDQIBRUNC-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 212.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|