C39H48N4O6 — CID 22378418
dibenzyl 2-[4-[[3-[(1-benzylpiperidin-4-yl)methyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]butanedioate (PubChem CID 22378418) has the molecular formula C39H48N4O6 and a molecular weight of 668.84 g/mol. Its IUPAC name is dibenzyl 2-[4-[[3-[(1-benzylpiperidin-4-yl)methyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]butanedioate.
| Compound Name | dibenzyl 2-[4-[[3-[(1-benzylpiperidin-4-yl)methyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]butanedioate |
|---|---|
| PubChem CID | 22378418 |
| Molecular Formula | C39H48N4O6 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.36 |
| IUPAC Name | dibenzyl 2-[4-[[3-[(1-benzylpiperidin-4-yl)methyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]butanedioate |
| SMILES | O=C(CC(C(=O)OCc1ccccc1)N1CCN(CC2CN(CC3CCN(Cc4ccccc4)CC3)C(=O)O2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C39H48N4O6/c44-37(47-29-33-12-6-2-7-13-33)24-36(38(45)48-30-34-14-8-3-9-15-34)42-22-20-41(21-23-42)27-35-28-43(39(46)49-35)26-32-16-18-40(19-17-32)25-31-10-4-1-5-11-31/h1-15,32,35-36H,16-30H2 |
| InChIKey | WOXUCQFYJJYIOV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 91.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|