C25H31N5O5 — CID 70344207
benzyl 3-[4-[[(5R)-3-(2-carbamimidoyl-4-hydroxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]propanoate (PubChem CID 70344207) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is benzyl 3-[4-[[(5R)-3-(2-carbamimidoyl-4-hydroxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]propanoate.
| Compound Name | benzyl 3-[4-[[(5R)-3-(2-carbamimidoyl-4-hydroxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 70344207 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | benzyl 3-[4-[[(5R)-3-(2-carbamimidoyl-4-hydroxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]propanoate |
| SMILES | [H]/N=C(\N)c1cc(O)ccc1N1C[C@@H](CN2CCN(CCC(=O)OCc3ccccc3)CC2)OC1=O |
| InChI | InChI=1S/C25H31N5O5/c26-24(27)21-14-19(31)6-7-22(21)30-16-20(35-25(30)33)15-29-12-10-28(11-13-29)9-8-23(32)34-17-18-4-2-1-3-5-18/h1-7,14,20,31H,8-13,15-17H2,(H3,26,27)/t20-/m1/s1 |
| InChIKey | LGJMEZYJEOCRIW-HXUWFJFHSA-N |
| XLogP | 1.75 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|