C26H29F3N8O2 — CID 22379307
N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide (PubChem CID 22379307) has the molecular formula C26H29F3N8O2 and a molecular weight of 542.57 g/mol. Its IUPAC name is N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide.
| Compound Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 22379307 |
| Molecular Formula | C26H29F3N8O2 |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
| SMILES | CC(=O)NCCNc1cc(NC(=O)CN2CCN(c3ncccc3C(F)(F)F)CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C26H29F3N8O2/c1-18(38)30-10-11-31-21-16-22(35-24(34-21)19-6-3-2-4-7-19)33-23(39)17-36-12-14-37(15-13-36)25-20(26(27,28)29)8-5-9-32-25/h2-9,16H,10-15,17H2,1H3,(H,30,38)(H2,31,33,34,35,39) |
| InChIKey | JLKRFNSKEXMEGZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|