C6H12N4 — CID 22380283
1,2-dimethyl-2H-pyrimidine-4,5-diamine (PubChem CID 22380283) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 1,2-dimethyl-2H-pyrimidine-4,5-diamine.
| Compound Name | 1,2-dimethyl-2H-pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22380283 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 1,2-dimethyl-2H-pyrimidine-4,5-diamine |
| SMILES | CC1N=C(N)C(N)=CN1C |
| InChI | InChI=1S/C6H12N4/c1-4-9-6(8)5(7)3-10(4)2/h3-4H,7H2,1-2H3,(H2,8,9) |
| InChIKey | JWSGTLPQXYMBPS-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |