C4H10N4 — CID 88913465
(E)-2,3-diamino-N'-methylprop-2-enimidamide (PubChem CID 88913465) has the molecular formula C4H10N4 and a molecular weight of 114.15 g/mol. Its IUPAC name is (E)-2,3-diamino-N'-methylprop-2-enimidamide.
| Compound Name | (E)-2,3-diamino-N'-methylprop-2-enimidamide |
|---|---|
| PubChem CID | 88913465 |
| Molecular Formula | C4H10N4 |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.09 |
| IUPAC Name | (E)-2,3-diamino-N'-methylprop-2-enimidamide |
| SMILES | C/N=C(N)/C(N)=C\N |
| InChI | InChI=1S/C4H10N4/c1-8-4(7)3(6)2-5/h2H,5-6H2,1H3,(H2,7,8)/b3-2+ |
| InChIKey | IJOPFNHCAQCLEA-NSCUHMNNSA-N |
| XLogP | -1.27 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|