C16H15N3O2 — CID 22382483
1-(2-pyridin-4-ylacetyl)-2,3-dihydroindole-6-carboxamide (PubChem CID 22382483) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-(2-pyridin-4-ylacetyl)-2,3-dihydroindole-6-carboxamide.
| Compound Name | 1-(2-pyridin-4-ylacetyl)-2,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 22382483 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-(2-pyridin-4-ylacetyl)-2,3-dihydroindole-6-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)N(C(=O)Cc1ccncc1)CC2 |
| InChI | InChI=1S/C16H15N3O2/c17-16(21)13-2-1-12-5-8-19(14(12)10-13)15(20)9-11-3-6-18-7-4-11/h1-4,6-7,10H,5,8-9H2,(H2,17,21) |
| InChIKey | BQMBSHIEBDSREQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |