C17H31N7O2 — CID 22387285
2-amino-N-[1-(2-cyanopyrrolidin-1-yl)-3-methyl-1-oxopentan-2-yl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 22387285) has the molecular formula C17H31N7O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-amino-N-[1-(2-cyanopyrrolidin-1-yl)-3-methyl-1-oxopentan-2-yl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | 2-amino-N-[1-(2-cyanopyrrolidin-1-yl)-3-methyl-1-oxopentan-2-yl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 22387285 |
| Molecular Formula | C17H31N7O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 2-amino-N-[1-(2-cyanopyrrolidin-1-yl)-3-methyl-1-oxopentan-2-yl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | CCC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)N1CCCC1C#N |
| InChI | InChI=1S/C17H31N7O2/c1-3-11(2)14(16(26)24-9-5-6-12(24)10-18)23-15(25)13(19)7-4-8-22-17(20)21/h11-14H,3-9,19H2,1-2H3,(H,23,25)(H4,20,21,22) |
| InChIKey | QWZOSTWQOAAJNU-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 163.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|