C11H11Cl2FO4S — CID 22389756
5,5-dichloro-5-(4-fluorophenyl)sulfinyl-3-hydroxypentanoic acid (PubChem CID 22389756) has the molecular formula C11H11Cl2FO4S and a molecular weight of 329.18 g/mol. Its IUPAC name is 5,5-dichloro-5-(4-fluorophenyl)sulfinyl-3-hydroxypentanoic acid.
| Compound Name | 5,5-dichloro-5-(4-fluorophenyl)sulfinyl-3-hydroxypentanoic acid |
|---|---|
| PubChem CID | 22389756 |
| Molecular Formula | C11H11Cl2FO4S |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 5,5-dichloro-5-(4-fluorophenyl)sulfinyl-3-hydroxypentanoic acid |
| SMILES | O=C(O)CC(O)CC(Cl)(Cl)S(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11Cl2FO4S/c12-11(13,6-8(15)5-10(16)17)19(18)9-3-1-7(14)2-4-9/h1-4,8,15H,5-6H2,(H,16,17) |
| InChIKey | APZRSXWQELHQIU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|