C13H15Cl2FO4S — CID 20802096
6,6-dichloro-6-(4-fluorophenyl)sulfonyl-4-methoxyhexan-2-one (PubChem CID 20802096) has the molecular formula C13H15Cl2FO4S and a molecular weight of 357.23 g/mol. Its IUPAC name is 6,6-dichloro-6-(4-fluorophenyl)sulfonyl-4-methoxyhexan-2-one.
| Compound Name | 6,6-dichloro-6-(4-fluorophenyl)sulfonyl-4-methoxyhexan-2-one |
|---|---|
| PubChem CID | 20802096 |
| Molecular Formula | C13H15Cl2FO4S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 6,6-dichloro-6-(4-fluorophenyl)sulfonyl-4-methoxyhexan-2-one |
| SMILES | COC(CC(C)=O)CC(Cl)(Cl)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H15Cl2FO4S/c1-9(17)7-11(20-2)8-13(14,15)21(18,19)12-5-3-10(16)4-6-12/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | NDBVNWMNYNTFKS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|