C12H14Cl2O3S — CID 20802089
5-(benzenesulfinyl)-5,5-dichloro-4-methoxypentan-2-one (PubChem CID 20802089) has the molecular formula C12H14Cl2O3S and a molecular weight of 309.21 g/mol. Its IUPAC name is 5-(benzenesulfinyl)-5,5-dichloro-4-methoxypentan-2-one.
| Compound Name | 5-(benzenesulfinyl)-5,5-dichloro-4-methoxypentan-2-one |
|---|---|
| PubChem CID | 20802089 |
| Molecular Formula | C12H14Cl2O3S |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 5-(benzenesulfinyl)-5,5-dichloro-4-methoxypentan-2-one |
| SMILES | COC(CC(C)=O)C(Cl)(Cl)S(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14Cl2O3S/c1-9(15)8-11(17-2)12(13,14)18(16)10-6-4-3-5-7-10/h3-7,11H,8H2,1-2H3 |
| InChIKey | QWDSIQSAFLGQSY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|