C13H16Cl2O4S — CID 20802099
6-(benzenesulfonyl)-6,6-dichloro-4-methoxyhexan-2-one (PubChem CID 20802099) has the molecular formula C13H16Cl2O4S and a molecular weight of 339.24 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-6,6-dichloro-4-methoxyhexan-2-one.
| Compound Name | 6-(benzenesulfonyl)-6,6-dichloro-4-methoxyhexan-2-one |
|---|---|
| PubChem CID | 20802099 |
| Molecular Formula | C13H16Cl2O4S |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 6-(benzenesulfonyl)-6,6-dichloro-4-methoxyhexan-2-one |
| SMILES | COC(CC(C)=O)CC(Cl)(Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16Cl2O4S/c1-10(16)8-11(19-2)9-13(14,15)20(17,18)12-6-4-3-5-7-12/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | LDCFLGOUTWINHS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|